CAS 268547-51-9 is the registry number for 4-Amino-3-(2,4-dichlorophenyl)pyrazole, 98%. Offered by: Combi-blocks. Available pack sizes: 25g, 5g, 100g, 1g.
5-(2,4-dichlorophenyl)-1H-pyrazol-4-amine (CAS 268547-51-9) is a chemical compound with the molecular formula C9H7Cl2N3 and a molecular weight of 228.07 g/mol. IUPAC name: 5-(2,4-dichlorophenyl)-1H-pyrazol-4-amine. InChIKey: HNNJZILWHYSZMW-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2N3 |
|---|---|
| Molecular weight | 228.07 g/mol |
| IUPAC name | 5-(2,4-dichlorophenyl)-1H-pyrazol-4-amine |
| InChIKey | HNNJZILWHYSZMW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)C2=C(C=NN2)N |
Computed by PubChem (NCBI)