CAS 1248105-63-6 is the registry number for 4-(Chloromethyl)-1-(2-chlorophenyl)-1h-1,2,3-triazole, 95%. Offered by: Combi-blocks. Available pack sizes: 250mg, 1g.
4-(chloromethyl)-1-(2-chlorophenyl)triazole (CAS 1248105-63-6) is a chemical compound with the molecular formula C9H7Cl2N3 and a molecular weight of 228.07 g/mol. IUPAC name: 4-(chloromethyl)-1-(2-chlorophenyl)triazole. InChIKey: PKKZVQSXNHZENX-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2N3 |
|---|---|
| Molecular weight | 228.07 g/mol |
| IUPAC name | 4-(chloromethyl)-1-(2-chlorophenyl)triazole |
| InChIKey | PKKZVQSXNHZENX-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C(=C1)N2C=C(N=N2)CCl)Cl |
Computed by PubChem (NCBI)