Products 112177-59-0
CAS 112177-59-0 appears in our catalog under these names: 4-(Chloromethyl)-1-(4-chlorophenyl)-1h-1,2,3-triazole, 95%, 4-(Chloromethyl)-1-(4-chlorophenyl)-1H-1,2,3-triazole. Offered by: Combi-blocks, Biosynth. Available pack sizes: 250mg, 1g, 0,5g, 50mg.
4-(chloromethyl)-1-(4-chlorophenyl)triazole (CAS 112177-59-0) is a chemical compound with the molecular formula C9H7Cl2N3 and a molecular weight of 228.07 g/mol. IUPAC name: 4-(chloromethyl)-1-(4-chlorophenyl)triazole. InChIKey: PJUZQOULZWELPK-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2N3 |
|---|---|
| Molecular weight | 228.07 g/mol |
| IUPAC name | 4-(chloromethyl)-1-(4-chlorophenyl)triazole |
| InChIKey | PJUZQOULZWELPK-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N2C=C(N=N2)CCl)Cl |
Computed by PubChem (NCBI)