Products 2864339-69-3
CAS 2864339-69-3 is the registry number for 2,4-Dichloro-6,7-dimethylpyrido[3,2-d]pyrimidine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,4-dichloro-6,7-dimethylpyrido[3,2-d]pyrimidine (CAS 2864339-69-3) is a chemical compound with the molecular formula C9H7Cl2N3 and a molecular weight of 228.07 g/mol. IUPAC name: 2,4-dichloro-6,7-dimethylpyrido[3,2-d]pyrimidine. InChIKey: IJLMFZFKDPXSER-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2N3 |
|---|---|
| Molecular weight | 228.07 g/mol |
| IUPAC name | 2,4-dichloro-6,7-dimethylpyrido[3,2-d]pyrimidine |
| InChIKey | IJLMFZFKDPXSER-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=NC(=N2)Cl)Cl)N=C1C |
Computed by PubChem (NCBI)