CAS 1215295-78-5 appears in our catalog under these names: 1-Benzyl-3,5-dichloro-1h-1,2,4-triazole, 95%, 1-Benzyl-3,5-dichloro-1H-1,2,4-triazole. Offered by: Combi-blocks, TRC. Available pack sizes: 25g, 10g, 1g, 5g, 250mg.
1-benzyl-3,5-dichloro-1,2,4-triazole (CAS 1215295-78-5) is a chemical compound with the molecular formula C9H7Cl2N3 and a molecular weight of 228.07 g/mol. IUPAC name: 1-benzyl-3,5-dichloro-1,2,4-triazole. InChIKey: LPEUFQNMMYSQFT-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2N3 |
|---|---|
| Molecular weight | 228.07 g/mol |
| IUPAC name | 1-benzyl-3,5-dichloro-1,2,4-triazole |
| InChIKey | LPEUFQNMMYSQFT-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=NC(=N2)Cl)Cl |
Computed by PubChem (NCBI)