Products 2882067-45-8
CAS 2882067-45-8 is the registry number for 5,8-Dichloro-3-ethylpyrido[2,3-d]pyridazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
5,8-dichloro-3-ethylpyrido[2,3-d]pyridazine (CAS 2882067-45-8) is a chemical compound with the molecular formula C9H7Cl2N3 and a molecular weight of 228.07 g/mol. IUPAC name: 5,8-dichloro-3-ethylpyrido[2,3-d]pyridazine. InChIKey: MNDKYCORWHMOAR-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2N3 |
|---|---|
| Molecular weight | 228.07 g/mol |
| IUPAC name | 5,8-dichloro-3-ethylpyrido[2,3-d]pyridazine |
| InChIKey | MNDKYCORWHMOAR-UHFFFAOYSA-N |
| SMILES | CCC1=CC2=C(C(=NN=C2Cl)Cl)N=C1 |
Computed by PubChem (NCBI)