CAS 1592561-70-0 is the registry number for 2,3-Dichloro-5,7-dimethylpyrido[3,4-b]pyrazine, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2,3-dichloro-5,7-dimethylpyrido[3,4-b]pyrazine (CAS 1592561-70-0) is a chemical compound with the molecular formula C9H7Cl2N3 and a molecular weight of 228.07 g/mol. IUPAC name: 2,3-dichloro-5,7-dimethylpyrido[3,4-b]pyrazine. InChIKey: AYMILDAJSOUPIL-UHFFFAOYSA-N.
| Molecular formula | C9H7Cl2N3 |
|---|---|
| Molecular weight | 228.07 g/mol |
| IUPAC name | 2,3-dichloro-5,7-dimethylpyrido[3,4-b]pyrazine |
| InChIKey | AYMILDAJSOUPIL-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C(=N1)C)N=C(C(=N2)Cl)Cl |
Computed by PubChem (NCBI)