CAS 103011-39-8 is the registry number for 3-(1,3-Dioxolan-2-yl)thiophene-2-sulfonamide, 95%. Offered by: AmBeed. Available pack sizes: 1g.
3-(1,3-dioxolan-2-yl)thiophene-2-sulfonamide (CAS 103011-39-8) is a chemical compound with the molecular formula C7H9NO4S2 and a molecular weight of 235.3 g/mol. IUPAC name: 3-(1,3-dioxolan-2-yl)thiophene-2-sulfonamide. InChIKey: ZMUFMHACHQMTOW-UHFFFAOYSA-N.
| Molecular formula | C7H9NO4S2 |
|---|---|
| Molecular weight | 235.3 g/mol |
| IUPAC name | 3-(1,3-dioxolan-2-yl)thiophene-2-sulfonamide |
| InChIKey | ZMUFMHACHQMTOW-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=C(SC=C2)S(=O)(=O)N |
Computed by PubChem (NCBI)