CAS 82068-11-9 is the registry number for 2-(Thiophene-2-sulfonamido)propanoic acid, 95%. Offered by: AmBeed. Available pack sizes: 5g.
2-(thiophen-2-ylsulfonylamino)propanoic acid (CAS 82068-11-9) is a chemical compound with the molecular formula C7H9NO4S2 and a molecular weight of 235.3 g/mol. IUPAC name: 2-(thiophen-2-ylsulfonylamino)propanoic acid. InChIKey: XIODLOBECJQIKS-UHFFFAOYSA-N.
| Molecular formula | C7H9NO4S2 |
|---|---|
| Molecular weight | 235.3 g/mol |
| IUPAC name | 2-(thiophen-2-ylsulfonylamino)propanoic acid |
| InChIKey | XIODLOBECJQIKS-UHFFFAOYSA-N |
| SMILES | CC(C(=O)O)NS(=O)(=O)C1=CC=CS1 |
Computed by PubChem (NCBI)