CAS 2241142-37-8 is the registry number for 5-(1,3-Dioxolan-2-yl)thiophene-3-sulfonamide. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
5-(1,3-dioxolan-2-yl)thiophene-3-sulfonamide (CAS 2241142-37-8) is a chemical compound with the molecular formula C7H9NO4S2 and a molecular weight of 235.3 g/mol. IUPAC name: 5-(1,3-dioxolan-2-yl)thiophene-3-sulfonamide. InChIKey: FHVBIRQMHQOAAS-UHFFFAOYSA-N.
| Molecular formula | C7H9NO4S2 |
|---|---|
| Molecular weight | 235.3 g/mol |
| IUPAC name | 5-(1,3-dioxolan-2-yl)thiophene-3-sulfonamide |
| InChIKey | FHVBIRQMHQOAAS-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=CC(=CS2)S(=O)(=O)N |
Computed by PubChem (NCBI)