CAS 59804-27-2 appears in our catalog under these names: Lornoxicam Impurity 13, Methyl 3-(N-methylsulfamoyl)thiophene-2-carboxylate, 95%, 95%. Offered by: Chemat Brand, Chemat. Available pack sizes: on request, 100mg, 250mg, 1g.
Methyl 3-(methylsulfamoyl)thiophene-2-carboxylate (CAS 59804-27-2) is a chemical compound with the molecular formula C7H9NO4S2 and a molecular weight of 235.3 g/mol. IUPAC name: methyl 3-(methylsulfamoyl)thiophene-2-carboxylate. InChIKey: GTRUHHWLEREHBP-UHFFFAOYSA-N.
| Molecular formula | C7H9NO4S2 |
|---|---|
| Molecular weight | 235.3 g/mol |
| IUPAC name | methyl 3-(methylsulfamoyl)thiophene-2-carboxylate |
| InChIKey | GTRUHHWLEREHBP-UHFFFAOYSA-N |
| SMILES | CNS(=O)(=O)C1=C(SC=C1)C(=O)OC |
Computed by PubChem (NCBI)