CAS 210827-40-0 is the registry number for 4-(1,3-Dioxolan-2-yl)thiophene-2-sulfonamide. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
4-(1,3-dioxolan-2-yl)thiophene-2-sulfonamide (CAS 210827-40-0) is a chemical compound with the molecular formula C7H9NO4S2 and a molecular weight of 235.3 g/mol. IUPAC name: 4-(1,3-dioxolan-2-yl)thiophene-2-sulfonamide. InChIKey: QQHXDULMKSMIGY-UHFFFAOYSA-N.
| Molecular formula | C7H9NO4S2 |
|---|---|
| Molecular weight | 235.3 g/mol |
| IUPAC name | 4-(1,3-dioxolan-2-yl)thiophene-2-sulfonamide |
| InChIKey | QQHXDULMKSMIGY-UHFFFAOYSA-N |
| SMILES | C1COC(O1)C2=CSC(=C2)S(=O)(=O)N |
Computed by PubChem (NCBI)