Products 82068-12-0

CAS 82068-12-0 is the registry number for 3-[(Thien-2-ylsulfonyl)amino]propanoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 5g, 10g, 250mg, 1g, 100mg.

Structural formula: {0} (CAS {1})

3-(thiophen-2-ylsulfonylamino)propanoic acid (CAS 82068-12-0) is a chemical compound with the molecular formula C7H9NO4S2 and a molecular weight of 235.3 g/mol. IUPAC name: 3-(thiophen-2-ylsulfonylamino)propanoic acid. InChIKey: PGHCOXJSXMMPHU-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9NO4S2
Molecular weight235.3 g/mol
IUPAC name3-(thiophen-2-ylsulfonylamino)propanoic acid
InChIKeyPGHCOXJSXMMPHU-UHFFFAOYSA-N
SMILESC1=CSC(=C1)S(=O)(=O)NCCC(=O)O

Computed by PubChem (NCBI)