Products 773145-51-0

CAS 773145-51-0 is the registry number for 4-(N,N-Dimethylsulfamoyl)thiophene-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

4-(dimethylsulfamoyl)thiophene-2-carboxylic acid (CAS 773145-51-0) is a chemical compound with the molecular formula C7H9NO4S2 and a molecular weight of 235.3 g/mol. IUPAC name: 4-(dimethylsulfamoyl)thiophene-2-carboxylic acid. InChIKey: JRDPILMFZHOUIF-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9NO4S2
Molecular weight235.3 g/mol
IUPAC name4-(dimethylsulfamoyl)thiophene-2-carboxylic acid
InChIKeyJRDPILMFZHOUIF-UHFFFAOYSA-N
SMILESCN(C)S(=O)(=O)C1=CSC(=C1)C(=O)O

Computed by PubChem (NCBI)