CAS 773145-51-0 is the registry number for 4-(N,N-Dimethylsulfamoyl)thiophene-2-carboxylic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
4-(dimethylsulfamoyl)thiophene-2-carboxylic acid (CAS 773145-51-0) is a chemical compound with the molecular formula C7H9NO4S2 and a molecular weight of 235.3 g/mol. IUPAC name: 4-(dimethylsulfamoyl)thiophene-2-carboxylic acid. InChIKey: JRDPILMFZHOUIF-UHFFFAOYSA-N.
| Molecular formula | C7H9NO4S2 |
|---|---|
| Molecular weight | 235.3 g/mol |
| IUPAC name | 4-(dimethylsulfamoyl)thiophene-2-carboxylic acid |
| InChIKey | JRDPILMFZHOUIF-UHFFFAOYSA-N |
| SMILES | CN(C)S(=O)(=O)C1=CSC(=C1)C(=O)O |
Computed by PubChem (NCBI)