CAS 317815-81-9 is the registry number for Methyl 4-(Aminosulfonyl)-5-Methylthiophene-3-Carboxylate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.
Methyl 5-methyl-4-sulfamoylthiophene-3-carboxylate (CAS 317815-81-9) is a chemical compound with the molecular formula C7H9NO4S2 and a molecular weight of 235.3 g/mol. IUPAC name: methyl 5-methyl-4-sulfamoylthiophene-3-carboxylate. InChIKey: HZYUFKOKLHCVKN-UHFFFAOYSA-N.
| Molecular formula | C7H9NO4S2 |
|---|---|
| Molecular weight | 235.3 g/mol |
| IUPAC name | methyl 5-methyl-4-sulfamoylthiophene-3-carboxylate |
| InChIKey | HZYUFKOKLHCVKN-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CS1)C(=O)OC)S(=O)(=O)N |
Computed by PubChem (NCBI)