Products 317815-81-9

CAS 317815-81-9 is the registry number for Methyl 4-(Aminosulfonyl)-5-Methylthiophene-3-Carboxylate. Offered by: Chemat Brand, TRC. Available pack sizes: on request, 100mg.

Structural formula: {0} (CAS {1})

Methyl 5-methyl-4-sulfamoylthiophene-3-carboxylate (CAS 317815-81-9) is a chemical compound with the molecular formula C7H9NO4S2 and a molecular weight of 235.3 g/mol. IUPAC name: methyl 5-methyl-4-sulfamoylthiophene-3-carboxylate. InChIKey: HZYUFKOKLHCVKN-UHFFFAOYSA-N.

Identity
Molecular formulaC7H9NO4S2
Molecular weight235.3 g/mol
IUPAC namemethyl 5-methyl-4-sulfamoylthiophene-3-carboxylate
InChIKeyHZYUFKOKLHCVKN-UHFFFAOYSA-N
SMILESCC1=C(C(=CS1)C(=O)OC)S(=O)(=O)N

Computed by PubChem (NCBI)