Products 1033805-88-7
CAS 1033805-88-7 appears in our catalog under these names: 1-(4-Bromo-2-fluorophenyl)-2,2,2-trifluoroethanol, 95%, 1-(4-Bromo-2-fluorophenyl)-2,2,2-trifluoroethanol, 98%, 1-(4-Bromo-2-fluorophenyl)-2,2,2-trifluoroethan-1-ol, 98%. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 5g, 100mg, 250mg.
1-(4-bromo-2-fluorophenyl)-2,2,2-trifluoroethanol (CAS 1033805-88-7) is a chemical compound with the molecular formula C8H5BrF4O and a molecular weight of 273.02 g/mol. IUPAC name: 1-(4-bromo-2-fluorophenyl)-2,2,2-trifluoroethanol. InChIKey: HXISGRVKWJITSF-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF4O |
|---|---|
| Molecular weight | 273.02 g/mol |
| IUPAC name | 1-(4-bromo-2-fluorophenyl)-2,2,2-trifluoroethanol |
| InChIKey | HXISGRVKWJITSF-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)F)C(C(F)(F)F)O |
Computed by PubChem (NCBI)