Products 1037087-60-7
CAS 1037087-60-7 is the registry number for 1-Benzyl-6-oxo-1,6-dihydropyridine-2-carboxylic acid 98%. Offered by: Ambeed. Available pack sizes: 100mg, 250mg, 1g.
1-benzyl-6-oxopyridine-2-carboxylic acid (CAS 1037087-60-7) is a chemical compound with the molecular formula C13H11NO3 and a molecular weight of 229.23 g/mol. IUPAC name: 1-benzyl-6-oxopyridine-2-carboxylic acid. InChIKey: HZEFWASVLRGDDY-UHFFFAOYSA-N.
| Molecular formula | C13H11NO3 |
|---|---|
| Molecular weight | 229.23 g/mol |
| IUPAC name | 1-benzyl-6-oxopyridine-2-carboxylic acid |
| InChIKey | HZEFWASVLRGDDY-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)CN2C(=O)C=CC=C2C(=O)O |
Computed by PubChem (NCBI)
Synonyms:
1-benzyl-6-oxo-1,6-dihydropyridine-2-carboxylic acid, HZEFWASVLRGDDY-UHFFFAOYSA-N, 1-benzyl-6-oxopyridine-2-carboxylic acid, 1-Benzyl-6-oxo-1,6-dihydropyridine-2-carboxylicacid, 1-benzyl-6-oxo-1,6-dihydro-pyridine-2-carboxylic acid, 2-Pyridinecarboxylic acid, 1,6-dihydro-6-oxo-1-(phenylmethyl)-