Products 1038696-41-1
CAS 1038696-41-1 appears in our catalog under these names: 3-(2,4-Dichlorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid, 95%, 3-(2,4-Dichlorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid. Offered by: Combi-blocks, AmBeed, Biosynth. Available pack sizes: 5g, 10g, 250mg, 100mg, 1g.
3-(2,4-dichlorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid (CAS 1038696-41-1) is a chemical compound with the molecular formula C10H7Cl2NO3 and a molecular weight of 260.07 g/mol. IUPAC name: 3-(2,4-dichlorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid. InChIKey: LSJWMFZQRLHGFI-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2NO3 |
|---|---|
| Molecular weight | 260.07 g/mol |
| IUPAC name | 3-(2,4-dichlorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid |
| InChIKey | LSJWMFZQRLHGFI-UHFFFAOYSA-N |
| SMILES | C1C(ON=C1C2=C(C=C(C=C2)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)