CAS 306935-72-8 is the registry number for (2E)-4-[(2,4-Dichlorophenyl)amino]-4-oxobut-2-enoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
(E)-4-(2,4-dichloroanilino)-4-oxobut-2-enoic acid (CAS 306935-72-8) is a chemical compound with the molecular formula C10H7Cl2NO3 and a molecular weight of 260.07 g/mol. IUPAC name: (E)-4-(2,4-dichloroanilino)-4-oxobut-2-enoic acid. InChIKey: WFWKZRKAECLVSE-ONEGZZNKSA-N.
| Molecular formula | C10H7Cl2NO3 |
|---|---|
| Molecular weight | 260.07 g/mol |
| IUPAC name | (E)-4-(2,4-dichloroanilino)-4-oxobut-2-enoic acid |
| InChIKey | WFWKZRKAECLVSE-ONEGZZNKSA-N |
| SMILES | C1=CC(=C(C=C1Cl)Cl)NC(=O)/C=C/C(=O)O |
Computed by PubChem (NCBI)