CAS 37904-05-5 is the registry number for 4-((2,6-Dichlorophenyl)amino)-4-oxobut-2-enoic acid, 95+%. Offered by: Chemat Brand. Available pack sizes: on request.
(E)-4-(2,6-dichloroanilino)-4-oxobut-2-enoic acid (CAS 37904-05-5) is a chemical compound with the molecular formula C10H7Cl2NO3 and a molecular weight of 260.07 g/mol. IUPAC name: (E)-4-(2,6-dichloroanilino)-4-oxobut-2-enoic acid. InChIKey: ZBWTXYMREBJGLL-SNAWJCMRSA-N.
| Molecular formula | C10H7Cl2NO3 |
|---|---|
| Molecular weight | 260.07 g/mol |
| IUPAC name | (E)-4-(2,6-dichloroanilino)-4-oxobut-2-enoic acid |
| InChIKey | ZBWTXYMREBJGLL-SNAWJCMRSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)NC(=O)/C=C/C(=O)O)Cl |
Computed by PubChem (NCBI)