Products 2014371-57-2
CAS 2014371-57-2 is the registry number for Ethyl 5,7-dichlorofuro[3,2-b]pyridine-2-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 5,7-dichlorofuro[3,2-b]pyridine-2-carboxylate (CAS 2014371-57-2) is a chemical compound with the molecular formula C10H7Cl2NO3 and a molecular weight of 260.07 g/mol. IUPAC name: ethyl 5,7-dichlorofuro[3,2-b]pyridine-2-carboxylate. InChIKey: KXDIHZUNXONJIU-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2NO3 |
|---|---|
| Molecular weight | 260.07 g/mol |
| IUPAC name | ethyl 5,7-dichlorofuro[3,2-b]pyridine-2-carboxylate |
| InChIKey | KXDIHZUNXONJIU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1=CC2=C(O1)C(=CC(=N2)Cl)Cl |
Computed by PubChem (NCBI)