Products 875006-82-9
CAS 875006-82-9 is the registry number for (6-Chloro-3-oxo-2,3-dihydro-benzo[1,4]oxazin-4-yl)-acetyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)acetyl chloride (CAS 875006-82-9) is a chemical compound with the molecular formula C10H7Cl2NO3 and a molecular weight of 260.07 g/mol. IUPAC name: 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)acetyl chloride. InChIKey: WBJWATHENOURRB-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2NO3 |
|---|---|
| Molecular weight | 260.07 g/mol |
| IUPAC name | 2-(6-chloro-3-oxo-1,4-benzoxazin-4-yl)acetyl chloride |
| InChIKey | WBJWATHENOURRB-UHFFFAOYSA-N |
| SMILES | C1C(=O)N(C2=C(O1)C=CC(=C2)Cl)CC(=O)Cl |
Computed by PubChem (NCBI)