Products 2090818-60-1
CAS 2090818-60-1 is the registry number for Methyl 3-amino-5,7-dichlorobenzofuran-2-carboxylate, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl 3-amino-5,7-dichloro-1-benzofuran-2-carboxylate (CAS 2090818-60-1) is a chemical compound with the molecular formula C10H7Cl2NO3 and a molecular weight of 260.07 g/mol. IUPAC name: methyl 3-amino-5,7-dichloro-1-benzofuran-2-carboxylate. InChIKey: BKNIUTFLJWHAMZ-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2NO3 |
|---|---|
| Molecular weight | 260.07 g/mol |
| IUPAC name | methyl 3-amino-5,7-dichloro-1-benzofuran-2-carboxylate |
| InChIKey | BKNIUTFLJWHAMZ-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C2=C(O1)C(=CC(=C2)Cl)Cl)N |
Computed by PubChem (NCBI)