CAS 21395-61-9 is the registry number for N-(3,4-Dichlorophenyl)maleamic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 25g, 1g, 5g.
(Z)-4-(3,4-dichloroanilino)-4-oxobut-2-enoic acid (CAS 21395-61-9) is a chemical compound with the molecular formula C10H7Cl2NO3 and a molecular weight of 260.07 g/mol. IUPAC name: (Z)-4-(3,4-dichloroanilino)-4-oxobut-2-enoic acid. InChIKey: YMYKNYVBUCMJOG-ARJAWSKDSA-N.
| Molecular formula | C10H7Cl2NO3 |
|---|---|
| Molecular weight | 260.07 g/mol |
| IUPAC name | (Z)-4-(3,4-dichloroanilino)-4-oxobut-2-enoic acid |
| InChIKey | YMYKNYVBUCMJOG-ARJAWSKDSA-N |
| SMILES | C1=CC(=C(C=C1NC(=O)/C=C\C(=O)O)Cl)Cl |
Computed by PubChem (NCBI)