CAS 109888-66-6 is the registry number for 3-(3,4-Dichlorophenyl)-4,5-dihydroisoxazole-5-carboxylic acid, 97%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(3,4-dichlorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid (CAS 109888-66-6) is a chemical compound with the molecular formula C10H7Cl2NO3 and a molecular weight of 260.07 g/mol. IUPAC name: 3-(3,4-dichlorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid. InChIKey: NDHFMONJGUAVQS-UHFFFAOYSA-N.
| Molecular formula | C10H7Cl2NO3 |
|---|---|
| Molecular weight | 260.07 g/mol |
| IUPAC name | 3-(3,4-dichlorophenyl)-4,5-dihydro-1,2-oxazole-5-carboxylic acid |
| InChIKey | NDHFMONJGUAVQS-UHFFFAOYSA-N |
| SMILES | C1C(ON=C1C2=CC(=C(C=C2)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)