CAS 1039715-62-2 appears in our catalog under these names: 4-(2-Cyanopropan-2-yl)benzene-1-sulfonyl chloride, 95+%, 4-(1-Cyano-1-methylethyl)benzene-1-sulfonyl chloride. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.
4-(2-cyanopropan-2-yl)benzenesulfonyl chloride (CAS 1039715-62-2) is a chemical compound with the molecular formula C10H10ClNO2S and a molecular weight of 243.71 g/mol. IUPAC name: 4-(2-cyanopropan-2-yl)benzenesulfonyl chloride. InChIKey: VYGSXSHFKAPNTB-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO2S |
|---|---|
| Molecular weight | 243.71 g/mol |
| IUPAC name | 4-(2-cyanopropan-2-yl)benzenesulfonyl chloride |
| InChIKey | VYGSXSHFKAPNTB-UHFFFAOYSA-N |
| SMILES | CC(C)(C#N)C1=CC=C(C=C1)S(=O)(=O)Cl |
Computed by PubChem (NCBI)