CAS 72678-81-0 is the registry number for 2-(2-Chlorophenyl)-1,3-thiazolidine-4-carboxylic acid. Offered by: Biosynth. Available pack sizes: 10g, 1g.
2-(2-chlorophenyl)-1,3-thiazolidine-4-carboxylic acid (CAS 72678-81-0) is a chemical compound with the molecular formula C10H10ClNO2S and a molecular weight of 243.71 g/mol. IUPAC name: 2-(2-chlorophenyl)-1,3-thiazolidine-4-carboxylic acid. InChIKey: JMNONJXMGLSVNV-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO2S |
|---|---|
| Molecular weight | 243.71 g/mol |
| IUPAC name | 2-(2-chlorophenyl)-1,3-thiazolidine-4-carboxylic acid |
| InChIKey | JMNONJXMGLSVNV-UHFFFAOYSA-N |
| SMILES | C1C(NC(S1)C2=CC=CC=C2Cl)C(=O)O |
Computed by PubChem (NCBI)