CAS 198991-78-5 is the registry number for (2R)-2-(4-Chlorophenyl)thiazolidine-4-carboxylic acid, 97%. Offered by: AmBeed. Available pack sizes: 5g, 1g.
(4R)-2-(4-chlorophenyl)-1,3-thiazolidine-4-carboxylic acid (CAS 198991-78-5) is a chemical compound with the molecular formula C10H10ClNO2S and a molecular weight of 243.71 g/mol. IUPAC name: (4R)-2-(4-chlorophenyl)-1,3-thiazolidine-4-carboxylic acid. InChIKey: LESQASCTNMKKPZ-IENPIDJESA-N.
| Molecular formula | C10H10ClNO2S |
|---|---|
| Molecular weight | 243.71 g/mol |
| IUPAC name | (4R)-2-(4-chlorophenyl)-1,3-thiazolidine-4-carboxylic acid |
| InChIKey | LESQASCTNMKKPZ-IENPIDJESA-N |
| SMILES | C1[C@H](NC(S1)C2=CC=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)