CAS 34491-29-7 appears in our catalog under these names: 2-(4-Chloro-phenyl)-thiazolidine-4-carboxylic acid, 95%, 2-(4-Chlorophenyl)thiazolidine-4-carboxylic acid, 95+%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 250mg, 1g, 5g.
2-(4-chlorophenyl)-1,3-thiazolidine-4-carboxylic acid (CAS 34491-29-7) is a chemical compound with the molecular formula C10H10ClNO2S and a molecular weight of 243.71 g/mol. IUPAC name: 2-(4-chlorophenyl)-1,3-thiazolidine-4-carboxylic acid. InChIKey: LESQASCTNMKKPZ-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO2S |
|---|---|
| Molecular weight | 243.71 g/mol |
| IUPAC name | 2-(4-chlorophenyl)-1,3-thiazolidine-4-carboxylic acid |
| InChIKey | LESQASCTNMKKPZ-UHFFFAOYSA-N |
| SMILES | C1C(NC(S1)C2=CC=C(C=C2)Cl)C(=O)O |
Computed by PubChem (NCBI)