CAS 1177425-20-5 appears in our catalog under these names: 1,2-Dimethyl-1H-indole-3-sulfonyl chloride, 1,2-Dimethyl-1H-indole-3-sulfonyl chloride 95%, 1,2-Dimethyl-1H-indole-3-sulfonyl chloride, 95%, 95%, 1,2-DIMETHYL-1H-INDOLE-3-SULFONYL CHLORIDE, 98%. Offered by: Biosynth, Ambeed, Chemat, Fluorochem. Available pack sizes: 1g, 0,5g, 100mg, 250mg.
1,2-dimethylindole-3-sulfonyl chloride (CAS 1177425-20-5) is a chemical compound with the molecular formula C10H10ClNO2S and a molecular weight of 243.71 g/mol. IUPAC name: 1,2-dimethylindole-3-sulfonyl chloride. InChIKey: FUBNHHWNQJIKOA-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO2S |
|---|---|
| Molecular weight | 243.71 g/mol |
| IUPAC name | 1,2-dimethylindole-3-sulfonyl chloride |
| InChIKey | FUBNHHWNQJIKOA-UHFFFAOYSA-N |
| SMILES | CC1=C(C2=CC=CC=C2N1C)S(=O)(=O)Cl |
Computed by PubChem (NCBI)