Products 2091771-57-0

CAS 2091771-57-0 is the registry number for 3-(2-Cyanopropan-2-yl)benzenesulfonyl chloride, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

3-(2-cyanopropan-2-yl)benzenesulfonyl chloride (CAS 2091771-57-0) is a chemical compound with the molecular formula C10H10ClNO2S and a molecular weight of 243.71 g/mol. IUPAC name: 3-(2-cyanopropan-2-yl)benzenesulfonyl chloride. InChIKey: FHAQDIKZNQFKNX-UHFFFAOYSA-N.

Identity
Molecular formulaC10H10ClNO2S
Molecular weight243.71 g/mol
IUPAC name3-(2-cyanopropan-2-yl)benzenesulfonyl chloride
InChIKeyFHAQDIKZNQFKNX-UHFFFAOYSA-N
SMILESCC(C)(C#N)C1=CC(=CC=C1)S(=O)(=O)Cl

Computed by PubChem (NCBI)