CAS 39565-75-8 is the registry number for 3-((4-Chlorophenyl)amino)-2,3-dihydrothiophene 1,1-dioxide, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(4-chlorophenyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine (CAS 39565-75-8) is a chemical compound with the molecular formula C10H10ClNO2S and a molecular weight of 243.71 g/mol. IUPAC name: N-(4-chlorophenyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine. InChIKey: FOLIKWVLWUMOBL-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO2S |
|---|---|
| Molecular weight | 243.71 g/mol |
| IUPAC name | N-(4-chlorophenyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine |
| InChIKey | FOLIKWVLWUMOBL-UHFFFAOYSA-N |
| SMILES | C1C(C=CS1(=O)=O)NC2=CC=C(C=C2)Cl |
Computed by PubChem (NCBI)