CAS 321977-85-9 is the registry number for N-(3-Chlorophenyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine. Offered by: Biosynth. Available pack sizes: 50mg, 0,5g.
N-(3-chlorophenyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine (CAS 321977-85-9) is a chemical compound with the molecular formula C10H10ClNO2S and a molecular weight of 243.71 g/mol. IUPAC name: N-(3-chlorophenyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine. InChIKey: UGUVUDMRBPYWNO-UHFFFAOYSA-N.
| Molecular formula | C10H10ClNO2S |
|---|---|
| Molecular weight | 243.71 g/mol |
| IUPAC name | N-(3-chlorophenyl)-1,1-dioxo-2,3-dihydrothiophen-3-amine |
| InChIKey | UGUVUDMRBPYWNO-UHFFFAOYSA-N |
| SMILES | C1C(C=CS1(=O)=O)NC2=CC(=CC=C2)Cl |
Computed by PubChem (NCBI)