CAS 1039827-16-1 appears in our catalog under these names: 1-(5-Bromo-2-fluorophenyl)-2,2,2-trifluoroethan-1-ol, 1-(5-bromo-2-fluorophenyl)-2,2,2-trifluoroethan-1-ol, 98%, 98%, 1-(5-Bromo-2-fluorophenyl)-2,2,2-trifluoroethanol, 98%. Offered by: Biosynth, Chemat, Fluorochem. Available pack sizes: 0,5g, 50mg, 100mg, 250mg, 1g.
1-(5-bromo-2-fluorophenyl)-2,2,2-trifluoroethanol (CAS 1039827-16-1) is a chemical compound with the molecular formula C8H5BrF4O and a molecular weight of 273.02 g/mol. IUPAC name: 1-(5-bromo-2-fluorophenyl)-2,2,2-trifluoroethanol. InChIKey: FRYOXCMTJUDLMZ-UHFFFAOYSA-N.
| Molecular formula | C8H5BrF4O |
|---|---|
| Molecular weight | 273.02 g/mol |
| IUPAC name | 1-(5-bromo-2-fluorophenyl)-2,2,2-trifluoroethanol |
| InChIKey | FRYOXCMTJUDLMZ-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1Br)C(C(F)(F)F)O)F |
Computed by PubChem (NCBI)