CAS 103999-44-6 is the registry number for 2-Amino-1-(2,3-dichlorophenyl)ethan-1-one hydrochloride. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
2-amino-1-(2,3-dichlorophenyl)ethanone;hydrochloride (CAS 103999-44-6) is a chemical compound with the molecular formula C8H8Cl3NO and a molecular weight of 240.5 g/mol. IUPAC name: 2-amino-1-(2,3-dichlorophenyl)ethanone;hydrochloride. InChIKey: YMUQHXQLXWKKND-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl3NO |
|---|---|
| Molecular weight | 240.5 g/mol |
| IUPAC name | 2-amino-1-(2,3-dichlorophenyl)ethanone;hydrochloride |
| InChIKey | YMUQHXQLXWKKND-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C(=C1)Cl)Cl)C(=O)CN.Cl |
Computed by PubChem (NCBI)