CAS 1258639-72-3 appears in our catalog under these names: 6,7-Dichloro-2,3-dihydro-1-benzofuran-3-amine hydrochloride, 95%, 6,7-Dichloro-2,3-dihydro-1-benzofuran-3-amine hydrochloride. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
6,7-dichloro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride (CAS 1258639-72-3) is a chemical compound with the molecular formula C8H8Cl3NO and a molecular weight of 240.5 g/mol. IUPAC name: 6,7-dichloro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride. InChIKey: WKSMBXXHCXDUIJ-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl3NO |
|---|---|
| Molecular weight | 240.5 g/mol |
| IUPAC name | 6,7-dichloro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride |
| InChIKey | WKSMBXXHCXDUIJ-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(O1)C(=C(C=C2)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)