Products 2378501-32-5
CAS 2378501-32-5 is the registry number for 5,7-Dichloro-2,3-dihydro-1-benzofuran-3-amine hydrochloride. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
5,7-dichloro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride (CAS 2378501-32-5) is a chemical compound with the molecular formula C8H8Cl3NO and a molecular weight of 240.5 g/mol. IUPAC name: 5,7-dichloro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride. InChIKey: PHTVILVETGBCEN-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl3NO |
|---|---|
| Molecular weight | 240.5 g/mol |
| IUPAC name | 5,7-dichloro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride |
| InChIKey | PHTVILVETGBCEN-UHFFFAOYSA-N |
| SMILES | C1C(C2=C(O1)C(=CC(=C2)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)