Products 2155856-51-0

CAS 2155856-51-0 is the registry number for Methyl 2,4-dichlorobenzene-1-carboximidate hydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.

Structural formula: {0} (CAS {1})

Methyl 2,4-dichlorobenzenecarboximidate;hydrochloride (CAS 2155856-51-0) is a chemical compound with the molecular formula C8H8Cl3NO and a molecular weight of 240.5 g/mol. IUPAC name: methyl 2,4-dichlorobenzenecarboximidate;hydrochloride. InChIKey: NUXLONIZDCEYAF-UHFFFAOYSA-N.

Identity
Molecular formulaC8H8Cl3NO
Molecular weight240.5 g/mol
IUPAC namemethyl 2,4-dichlorobenzenecarboximidate;hydrochloride
InChIKeyNUXLONIZDCEYAF-UHFFFAOYSA-N
SMILESCOC(=N)C1=C(C=C(C=C1)Cl)Cl.Cl

Computed by PubChem (NCBI)