CAS 2155856-51-0 is the registry number for Methyl 2,4-dichlorobenzene-1-carboximidate hydrochloride. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
Methyl 2,4-dichlorobenzenecarboximidate;hydrochloride (CAS 2155856-51-0) is a chemical compound with the molecular formula C8H8Cl3NO and a molecular weight of 240.5 g/mol. IUPAC name: methyl 2,4-dichlorobenzenecarboximidate;hydrochloride. InChIKey: NUXLONIZDCEYAF-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl3NO |
|---|---|
| Molecular weight | 240.5 g/mol |
| IUPAC name | methyl 2,4-dichlorobenzenecarboximidate;hydrochloride |
| InChIKey | NUXLONIZDCEYAF-UHFFFAOYSA-N |
| SMILES | COC(=N)C1=C(C=C(C=C1)Cl)Cl.Cl |
Computed by PubChem (NCBI)