CAS 26398-84-5 is the registry number for 2-(2-Aminoethoxy)-1,3,5-trichlorobenzene. Offered by: Biosynth. Available pack sizes: 100mg, 1g.
2-(2,4,6-trichlorophenoxy)ethanamine (CAS 26398-84-5) is a chemical compound with the molecular formula C8H8Cl3NO and a molecular weight of 240.5 g/mol. IUPAC name: 2-(2,4,6-trichlorophenoxy)ethanamine. InChIKey: SUSCJRQKCYABMX-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl3NO |
|---|---|
| Molecular weight | 240.5 g/mol |
| IUPAC name | 2-(2,4,6-trichlorophenoxy)ethanamine |
| InChIKey | SUSCJRQKCYABMX-UHFFFAOYSA-N |
| SMILES | C1=C(C=C(C(=C1Cl)OCCN)Cl)Cl |
Computed by PubChem (NCBI)