CAS 41995-19-1 appears in our catalog under these names: 2-(3,4-Dichlorophenyl)-2-oxoethylamine hydrochloride, 95%, 2-(3,4-Dichlorophenyl)-2-oxoethylamineHydrochloride. Offered by: Combi-blocks, Biosynth. Available pack sizes: 5g, 1g, 250mg, 10g, 2g.
2-amino-1-(3,4-dichlorophenyl)ethanone;hydrochloride (CAS 41995-19-1) is a chemical compound with the molecular formula C8H8Cl3NO and a molecular weight of 240.5 g/mol. IUPAC name: 2-amino-1-(3,4-dichlorophenyl)ethanone;hydrochloride. InChIKey: IDRFAFYEURFRFD-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl3NO |
|---|---|
| Molecular weight | 240.5 g/mol |
| IUPAC name | 2-amino-1-(3,4-dichlorophenyl)ethanone;hydrochloride |
| InChIKey | IDRFAFYEURFRFD-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C(=O)CN)Cl)Cl.Cl |
Computed by PubChem (NCBI)