Products 2415751-61-8
CAS 2415751-61-8 is the registry number for (S)-5,7-Dichloro-2,3-dihydrobenzofuran-3-amine hydrochloride, 95%, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg.
(3S)-5,7-dichloro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride (CAS 2415751-61-8) is a chemical compound with the molecular formula C8H8Cl3NO and a molecular weight of 240.5 g/mol. IUPAC name: (3S)-5,7-dichloro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride. InChIKey: PHTVILVETGBCEN-OGFXRTJISA-N.
| Molecular formula | C8H8Cl3NO |
|---|---|
| Molecular weight | 240.5 g/mol |
| IUPAC name | (3S)-5,7-dichloro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride |
| InChIKey | PHTVILVETGBCEN-OGFXRTJISA-N |
| SMILES | C1[C@H](C2=C(O1)C(=CC(=C2)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)