CAS 2725790-82-7 appears in our catalog under these names: 5,6-Dichloro-2,3-dihydrobenzofuran-3-amine hydrochloride, 98%, 5,6-dichloro-2,3-dihydrobenzofuran-3-amine hydrochloride, 97%, 97%, 5,6-dichloro-2,3-dihydrobenzofuran-3-amine,hydrochloride, 97%. Offered by: AmBeed, Chemat, Fluorochem. Available pack sizes: 1g, 100mg, 250mg, 500mg.
5,6-dichloro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride (CAS 2725790-82-7) is a chemical compound with the molecular formula C8H8Cl3NO and a molecular weight of 240.5 g/mol. IUPAC name: 5,6-dichloro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride. InChIKey: DIYOJCOUTPFSSH-UHFFFAOYSA-N.
| Molecular formula | C8H8Cl3NO |
|---|---|
| Molecular weight | 240.5 g/mol |
| IUPAC name | 5,6-dichloro-2,3-dihydro-1-benzofuran-3-amine;hydrochloride |
| InChIKey | DIYOJCOUTPFSSH-UHFFFAOYSA-N |
| SMILES | C1C(C2=CC(=C(C=C2O1)Cl)Cl)N.Cl |
Computed by PubChem (NCBI)