CAS 104023-75-8 is the registry number for 2,2-Dichloro-1-(4-ethoxyphenyl)cyclopropanecarboxylic acid, 95+%. Offered by: AmBeed. Available pack sizes: 1g.
2,2-dichloro-1-(4-ethoxyphenyl)cyclopropane-1-carboxylic acid (CAS 104023-75-8) is a chemical compound with the molecular formula C12H12Cl2O3 and a molecular weight of 275.12 g/mol. IUPAC name: 2,2-dichloro-1-(4-ethoxyphenyl)cyclopropane-1-carboxylic acid. InChIKey: DQXVWYCZSNWWIU-UHFFFAOYSA-N.
| Molecular formula | C12H12Cl2O3 |
|---|---|
| Molecular weight | 275.12 g/mol |
| IUPAC name | 2,2-dichloro-1-(4-ethoxyphenyl)cyclopropane-1-carboxylic acid |
| InChIKey | DQXVWYCZSNWWIU-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)C2(CC2(Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)