CAS 194240-93-2 is the registry number for Ethyl 4-(2,4-dichlorophenyl)-3-oxobutanoate, 95%. Offered by: AmBeed. Available pack sizes: 5g.
Ethyl 4-(2,4-dichlorophenyl)-3-oxobutanoate (CAS 194240-93-2) is a chemical compound with the molecular formula C12H12Cl2O3 and a molecular weight of 275.12 g/mol. IUPAC name: ethyl 4-(2,4-dichlorophenyl)-3-oxobutanoate. InChIKey: NBOADHPKDZYTFK-UHFFFAOYSA-N.
| Molecular formula | C12H12Cl2O3 |
|---|---|
| Molecular weight | 275.12 g/mol |
| IUPAC name | ethyl 4-(2,4-dichlorophenyl)-3-oxobutanoate |
| InChIKey | NBOADHPKDZYTFK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)CC(=O)CC1=C(C=C(C=C1)Cl)Cl |
Computed by PubChem (NCBI)