Products 1048916-53-5

CAS 1048916-53-5 is the registry number for 4-(3,4-Dichloro-phenyl)-3-oxo-butyric acid ethyl ester, 98%. Offered by: Fluorochem. Available pack sizes: 1g.

Structural formula: {0} (CAS {1})

Ethyl 4-(3,4-dichlorophenyl)-3-oxobutanoate (CAS 1048916-53-5) is a chemical compound with the molecular formula C12H12Cl2O3 and a molecular weight of 275.12 g/mol. IUPAC name: ethyl 4-(3,4-dichlorophenyl)-3-oxobutanoate. InChIKey: KVPXHWRVOGRAJG-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12Cl2O3
Molecular weight275.12 g/mol
IUPAC nameethyl 4-(3,4-dichlorophenyl)-3-oxobutanoate
InChIKeyKVPXHWRVOGRAJG-UHFFFAOYSA-N
SMILESCCOC(=O)CC(=O)CC1=CC(=C(C=C1)Cl)Cl

Computed by PubChem (NCBI)