CAS 1152567-67-3 appears in our catalog under these names: 4-(2,4-Dichlorophenyl)oxane-4-carboxylic acid, 95%, 4-(2,4-Dichlorophenyl)oxane-4-carboxylic acid. Offered by: AmBeed, Biosynth. Available pack sizes: 5g, 0,5g, 50mg.
4-(2,4-dichlorophenyl)oxane-4-carboxylic acid (CAS 1152567-67-3) is a chemical compound with the molecular formula C12H12Cl2O3 and a molecular weight of 275.12 g/mol. IUPAC name: 4-(2,4-dichlorophenyl)oxane-4-carboxylic acid. InChIKey: XFQPNIVUNWVKAI-UHFFFAOYSA-N.
| Molecular formula | C12H12Cl2O3 |
|---|---|
| Molecular weight | 275.12 g/mol |
| IUPAC name | 4-(2,4-dichlorophenyl)oxane-4-carboxylic acid |
| InChIKey | XFQPNIVUNWVKAI-UHFFFAOYSA-N |
| SMILES | C1COCCC1(C2=C(C=C(C=C2)Cl)Cl)C(=O)O |
Computed by PubChem (NCBI)