CAS 2055274-89-8 is the registry number for tert-Butyl 2,4-dichloro-3-formylbenzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Tert-butyl 2,4-dichloro-3-formylbenzoate (CAS 2055274-89-8) is a chemical compound with the molecular formula C12H12Cl2O3 and a molecular weight of 275.12 g/mol. IUPAC name: tert-butyl 2,4-dichloro-3-formylbenzoate. InChIKey: YTGBPZMHQRYUGQ-UHFFFAOYSA-N.
| Molecular formula | C12H12Cl2O3 |
|---|---|
| Molecular weight | 275.12 g/mol |
| IUPAC name | tert-butyl 2,4-dichloro-3-formylbenzoate |
| InChIKey | YTGBPZMHQRYUGQ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=C(C(=C(C=C1)Cl)C=O)Cl |
Computed by PubChem (NCBI)