Products 2055274-89-8

CAS 2055274-89-8 is the registry number for tert-Butyl 2,4-dichloro-3-formylbenzoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

Tert-butyl 2,4-dichloro-3-formylbenzoate (CAS 2055274-89-8) is a chemical compound with the molecular formula C12H12Cl2O3 and a molecular weight of 275.12 g/mol. IUPAC name: tert-butyl 2,4-dichloro-3-formylbenzoate. InChIKey: YTGBPZMHQRYUGQ-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12Cl2O3
Molecular weight275.12 g/mol
IUPAC nametert-butyl 2,4-dichloro-3-formylbenzoate
InChIKeyYTGBPZMHQRYUGQ-UHFFFAOYSA-N
SMILESCC(C)(C)OC(=O)C1=C(C(=C(C=C1)Cl)C=O)Cl

Computed by PubChem (NCBI)