CAS 2110273-53-3 is the registry number for Ethyl 7,8-dichlorochromane-3-carboxylate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Ethyl 7,8-dichloro-3,4-dihydro-2H-chromene-3-carboxylate (CAS 2110273-53-3) is a chemical compound with the molecular formula C12H12Cl2O3 and a molecular weight of 275.12 g/mol. IUPAC name: ethyl 7,8-dichloro-3,4-dihydro-2H-chromene-3-carboxylate. InChIKey: NLBZCSILAHSIOK-UHFFFAOYSA-N.
| Molecular formula | C12H12Cl2O3 |
|---|---|
| Molecular weight | 275.12 g/mol |
| IUPAC name | ethyl 7,8-dichloro-3,4-dihydro-2H-chromene-3-carboxylate |
| InChIKey | NLBZCSILAHSIOK-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C1CC2=C(C(=C(C=C2)Cl)Cl)OC1 |
Computed by PubChem (NCBI)