CAS 1272528-03-6 is the registry number for 3,5-Dichloro-4-(cyclopentyloxy)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.
3,5-dichloro-4-cyclopentyloxybenzoic acid (CAS 1272528-03-6) is a chemical compound with the molecular formula C12H12Cl2O3 and a molecular weight of 275.12 g/mol. IUPAC name: 3,5-dichloro-4-cyclopentyloxybenzoic acid. InChIKey: VXAQPSDNOMOLCN-UHFFFAOYSA-N.
| Molecular formula | C12H12Cl2O3 |
|---|---|
| Molecular weight | 275.12 g/mol |
| IUPAC name | 3,5-dichloro-4-cyclopentyloxybenzoic acid |
| InChIKey | VXAQPSDNOMOLCN-UHFFFAOYSA-N |
| SMILES | C1CCC(C1)OC2=C(C=C(C=C2Cl)C(=O)O)Cl |
Computed by PubChem (NCBI)