Products 1272528-03-6

CAS 1272528-03-6 is the registry number for 3,5-Dichloro-4-(cyclopentyloxy)benzoic acid, 95%. Offered by: Combi-blocks. Available pack sizes: 1g, 5g.

Structural formula: {0} (CAS {1})

3,5-dichloro-4-cyclopentyloxybenzoic acid (CAS 1272528-03-6) is a chemical compound with the molecular formula C12H12Cl2O3 and a molecular weight of 275.12 g/mol. IUPAC name: 3,5-dichloro-4-cyclopentyloxybenzoic acid. InChIKey: VXAQPSDNOMOLCN-UHFFFAOYSA-N.

Identity
Molecular formulaC12H12Cl2O3
Molecular weight275.12 g/mol
IUPAC name3,5-dichloro-4-cyclopentyloxybenzoic acid
InChIKeyVXAQPSDNOMOLCN-UHFFFAOYSA-N
SMILESC1CCC(C1)OC2=C(C=C(C=C2Cl)C(=O)O)Cl

Computed by PubChem (NCBI)