CAS 1808618-94-1 is the registry number for Methyl 4-(2,4-dichlorophenoxy)-2-methylbut-2-enoate, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
Methyl (E)-4-(2,4-dichlorophenoxy)-2-methylbut-2-enoate (CAS 1808618-94-1) is a chemical compound with the molecular formula C12H12Cl2O3 and a molecular weight of 275.12 g/mol. IUPAC name: methyl (E)-4-(2,4-dichlorophenoxy)-2-methylbut-2-enoate. InChIKey: PEEKOSHKFXKMMH-VMPITWQZSA-N.
| Molecular formula | C12H12Cl2O3 |
|---|---|
| Molecular weight | 275.12 g/mol |
| IUPAC name | methyl (E)-4-(2,4-dichlorophenoxy)-2-methylbut-2-enoate |
| InChIKey | PEEKOSHKFXKMMH-VMPITWQZSA-N |
| SMILES | C/C(=C\COC1=C(C=C(C=C1)Cl)Cl)/C(=O)OC |
Computed by PubChem (NCBI)